C22H23ClF3N7OSi — CID 170970814
4-chloro-N-[3-(trifluoromethyl)phenyl]-6-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]-1,3,5-triazin-2-amine (PubChem CID 170970814) has the molecular formula C22H23ClF3N7OSi and a molecular weight of 522.01 g/mol. Its IUPAC name is 4-chloro-N-[3-(trifluoromethyl)phenyl]-6-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-[3-(trifluoromethyl)phenyl]-6-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 170970814 |
| Molecular Formula | C22H23ClF3N7OSi |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-chloro-N-[3-(trifluoromethyl)phenyl]-6-[1-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-6-yl]-1,3,5-triazin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1cnc2ncc(-c3nc(Cl)nc(Nc4cccc(C(F)(F)F)c4)n3)cc21 |
| InChI | InChI=1S/C22H23ClF3N7OSi/c1-35(2,3)8-7-34-13-33-12-28-19-17(33)9-14(11-27-19)18-30-20(23)32-21(31-18)29-16-6-4-5-15(10-16)22(24,25)26/h4-6,9-12H,7-8,13H2,1-3H3,(H,29,30,31,32) |
| InChIKey | HTJLZUZHTPHRON-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|