C24H26F3N3OSi — CID 155742443
7-(trifluoromethyl)-N-[1-(2-trimethylsilylethoxymethyl)indol-6-yl]quinolin-2-amine (PubChem CID 155742443) has the molecular formula C24H26F3N3OSi and a molecular weight of 457.57 g/mol. Its IUPAC name is 7-(trifluoromethyl)-N-[1-(2-trimethylsilylethoxymethyl)indol-6-yl]quinolin-2-amine.
| Compound Name | 7-(trifluoromethyl)-N-[1-(2-trimethylsilylethoxymethyl)indol-6-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 155742443 |
| Molecular Formula | C24H26F3N3OSi |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 7-(trifluoromethyl)-N-[1-(2-trimethylsilylethoxymethyl)indol-6-yl]quinolin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2ccc(Nc3ccc4ccc(C(F)(F)F)cc4n3)cc21 |
| InChI | InChI=1S/C24H26F3N3OSi/c1-32(2,3)13-12-31-16-30-11-10-18-5-8-20(15-22(18)30)28-23-9-6-17-4-7-19(24(25,26)27)14-21(17)29-23/h4-11,14-15H,12-13,16H2,1-3H3,(H,28,29) |
| InChIKey | MGDXWQCSJVDDOL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|