C19H27F3N4O2Si — CID 162388348
2-[[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methylamino]-4-(trifluoromethyl)benzamide (PubChem CID 162388348) has the molecular formula C19H27F3N4O2Si and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methylamino]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-[[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methylamino]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162388348 |
| Molecular Formula | C19H27F3N4O2Si |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methylamino]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1nc(CNc2cc(C(F)(F)F)ccc2C(N)=O)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H27F3N4O2Si/c1-13-25-15(11-26(13)12-28-7-8-29(2,3)4)10-24-17-9-14(19(20,21)22)5-6-16(17)18(23)27/h5-6,9,11,24H,7-8,10,12H2,1-4H3,(H2,23,27) |
| InChIKey | XLQLRKABDOKWMY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|