C22H34FN5O3Si — CID 160996950
2-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]oxy-5-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyridine-3-carboxamide (PubChem CID 160996950) has the molecular formula C22H34FN5O3Si and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]oxy-5-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]oxy-5-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160996950 |
| Molecular Formula | C22H34FN5O3Si |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 2-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]oxy-5-[2-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cnc(O[C@@H]3CCN(C)C[C@@H]3F)c(C(N)=O)c2)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H34FN5O3Si/c1-15-26-19(13-28(15)14-30-8-9-32(3,4)5)16-10-17(21(24)29)22(25-11-16)31-20-6-7-27(2)12-18(20)23/h10-11,13,18,20H,6-9,12,14H2,1-5H3,(H2,24,29)/t18-,20+/m0/s1 |
| InChIKey | TVJKJGBYMHIAKK-AZUAARDMSA-N |
| XLogP | 3.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|