C19H21BrClF3N4O2Si — CID 162388305
1-[[2-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]-4-chloro-7-(trifluoromethyl)quinazolin-2-one (PubChem CID 162388305) has the molecular formula C19H21BrClF3N4O2Si and a molecular weight of 537.84 g/mol. Its IUPAC name is 1-[[2-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]-4-chloro-7-(trifluoromethyl)quinazolin-2-one.
| Compound Name | 1-[[2-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]-4-chloro-7-(trifluoromethyl)quinazolin-2-one |
|---|---|
| PubChem CID | 162388305 |
| Molecular Formula | C19H21BrClF3N4O2Si |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 1-[[2-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]-4-chloro-7-(trifluoromethyl)quinazolin-2-one |
| SMILES | C[Si](C)(C)CCOCn1cc(Cn2c(=O)nc(Cl)c3ccc(C(F)(F)F)cc32)nc1Br |
| InChI | InChI=1S/C19H21BrClF3N4O2Si/c1-31(2,3)7-6-30-11-27-9-13(25-17(27)20)10-28-15-8-12(19(22,23)24)4-5-14(15)16(21)26-18(28)29/h4-5,8-9H,6-7,10-11H2,1-3H3 |
| InChIKey | VBCBICOTOWBDKV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|