C18H22Cl2N4O2Si — CID 162388393
4,7-dichloro-1-[[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]quinazolin-2-one (PubChem CID 162388393) has the molecular formula C18H22Cl2N4O2Si and a molecular weight of 425.39 g/mol. Its IUPAC name is 4,7-dichloro-1-[[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]quinazolin-2-one.
| Compound Name | 4,7-dichloro-1-[[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]quinazolin-2-one |
|---|---|
| PubChem CID | 162388393 |
| Molecular Formula | C18H22Cl2N4O2Si |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4,7-dichloro-1-[[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]methyl]quinazolin-2-one |
| SMILES | C[Si](C)(C)CCOCn1cnc(Cn2c(=O)nc(Cl)c3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C18H22Cl2N4O2Si/c1-27(2,3)7-6-26-12-23-9-14(21-11-23)10-24-16-8-13(19)4-5-15(16)17(20)22-18(24)25/h4-5,8-9,11H,6-7,10,12H2,1-3H3 |
| InChIKey | HLKOMIDAPUKYTK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|