C19H26ClN5O2Si — CID 154441350
2-[(1S)-1-aminoethyl]-5-chloro-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-4-one (PubChem CID 154441350) has the molecular formula C19H26ClN5O2Si and a molecular weight of 419.99 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-5-chloro-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-4-one.
| Compound Name | 2-[(1S)-1-aminoethyl]-5-chloro-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 154441350 |
| Molecular Formula | C19H26ClN5O2Si |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-5-chloro-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-4-one |
| SMILES | C[C@H](N)c1nc2cccc(Cl)c2c(=O)n1-c1cn(COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C19H26ClN5O2Si/c1-13(21)18-23-15-7-5-6-14(20)17(15)19(26)25(18)16-10-24(11-22-16)12-27-8-9-28(2,3)4/h5-7,10-11,13H,8-9,12,21H2,1-4H3/t13-/m0/s1 |
| InChIKey | QNWUAPWOOATPEK-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|