C24H29ClN10O2Si — CID 131744859
2,4-diamino-6-[[(1S)-1-[5-chloro-4-oxo-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 131744859) has the molecular formula C24H29ClN10O2Si and a molecular weight of 553.10 g/mol. Its IUPAC name is 2,4-diamino-6-[[(1S)-1-[5-chloro-4-oxo-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[[(1S)-1-[5-chloro-4-oxo-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 131744859 |
| Molecular Formula | C24H29ClN10O2Si |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2,4-diamino-6-[[(1S)-1-[5-chloro-4-oxo-3-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinazolin-2-yl]ethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C[C@H](Nc1nc(N)nc(N)c1C#N)c1nc2cccc(Cl)c2c(=O)n1-c1cn(COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C24H29ClN10O2Si/c1-14(30-21-15(10-26)20(27)32-24(28)33-21)22-31-17-7-5-6-16(25)19(17)23(36)35(22)18-11-34(12-29-18)13-37-8-9-38(2,3)4/h5-7,11-12,14H,8-9,13H2,1-4H3,(H5,27,28,30,32,33)/t14-/m0/s1 |
| InChIKey | ZIAGNNQDVMTWSE-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 175.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|