C17H23ClN4O2 — CID 118573634
2-(1-aminoethyl)-5-chloro-3-(3-morpholin-4-ylpropyl)quinazolin-4-one (PubChem CID 118573634) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-chloro-3-(3-morpholin-4-ylpropyl)quinazolin-4-one.
| Compound Name | 2-(1-aminoethyl)-5-chloro-3-(3-morpholin-4-ylpropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 118573634 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(1-aminoethyl)-5-chloro-3-(3-morpholin-4-ylpropyl)quinazolin-4-one |
| SMILES | CC(N)c1nc2cccc(Cl)c2c(=O)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C17H23ClN4O2/c1-12(19)16-20-14-5-2-4-13(18)15(14)17(23)22(16)7-3-6-21-8-10-24-11-9-21/h2,4-5,12H,3,6-11,19H2,1H3 |
| InChIKey | IYMVGGRREYNZRS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |