C17H15Cl2N3O — CID 155000155
2-(1-aminoethyl)-5-chloro-3-[(2-chlorophenyl)methyl]quinazolin-4-one (PubChem CID 155000155) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-chloro-3-[(2-chlorophenyl)methyl]quinazolin-4-one.
| Compound Name | 2-(1-aminoethyl)-5-chloro-3-[(2-chlorophenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 155000155 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(1-aminoethyl)-5-chloro-3-[(2-chlorophenyl)methyl]quinazolin-4-one |
| SMILES | CC(N)c1nc2cccc(Cl)c2c(=O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O/c1-10(20)16-21-14-8-4-7-13(19)15(14)17(23)22(16)9-11-5-2-3-6-12(11)18/h2-8,10H,9,20H2,1H3 |
| InChIKey | KEPXMBBPNBODRY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |