C17H33ClN2OSiSn — CID 159759236
2-[(5-chloro-3-trimethylstannylindazol-1-yl)methoxy]ethyl-trimethylsilane;deuterium monohydride;methane (PubChem CID 159759236) has the molecular formula C17H33ClN2OSiSn and a molecular weight of 464.72 g/mol. Its IUPAC name is 2-[(5-chloro-3-trimethylstannylindazol-1-yl)methoxy]ethyl-trimethylsilane;deuterium monohydride;methane.
| Compound Name | 2-[(5-chloro-3-trimethylstannylindazol-1-yl)methoxy]ethyl-trimethylsilane;deuterium monohydride;methane |
|---|---|
| PubChem CID | 159759236 |
| Molecular Formula | C17H33ClN2OSiSn |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-[(5-chloro-3-trimethylstannylindazol-1-yl)methoxy]ethyl-trimethylsilane;deuterium monohydride;methane |
| SMILES | C.C[Si](C)(C)CCOCn1nc([Sn](C)(C)C)c2cc(Cl)ccc21.[H][2H] |
| InChI | InChI=1S/C13H18ClN2OSi.CH4.3CH3.Sn.H2/c1-18(2,3)7-6-17-10-16-13-5-4-12(14)8-11(13)9-15-16;;;;;;/h4-5,8H,6-7,10H2,1-3H3;1H4;3*1H3;;1H/i;;;;;;1+1 |
| InChIKey | NEQWIEYFZUYSSK-KTTJZPQESA-N |
| XLogP | 5.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|