C18H23Cl2N3O3Si — CID 69217418
6-chloro-N-[(4-chlorophenyl)methyl]-3-oxo-2-(2-trimethylsilylethoxymethyl)pyridazine-4-carboxamide (PubChem CID 69217418) has the molecular formula C18H23Cl2N3O3Si and a molecular weight of 428.39 g/mol. Its IUPAC name is 6-chloro-N-[(4-chlorophenyl)methyl]-3-oxo-2-(2-trimethylsilylethoxymethyl)pyridazine-4-carboxamide.
| Compound Name | 6-chloro-N-[(4-chlorophenyl)methyl]-3-oxo-2-(2-trimethylsilylethoxymethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 69217418 |
| Molecular Formula | C18H23Cl2N3O3Si |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 6-chloro-N-[(4-chlorophenyl)methyl]-3-oxo-2-(2-trimethylsilylethoxymethyl)pyridazine-4-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(Cl)cc(C(=O)NCc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C18H23Cl2N3O3Si/c1-27(2,3)9-8-26-12-23-18(25)15(10-16(20)22-23)17(24)21-11-13-4-6-14(19)7-5-13/h4-7,10H,8-9,11-12H2,1-3H3,(H,21,24) |
| InChIKey | LJOZIPCRAQXELJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|