C18H21BrFN3OSi — CID 171839827
2-[[3-(2-bromo-5-fluoro-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171839827) has the molecular formula C18H21BrFN3OSi and a molecular weight of 422.37 g/mol. Its IUPAC name is 2-[[3-(2-bromo-5-fluoro-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(2-bromo-5-fluoro-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171839827 |
| Molecular Formula | C18H21BrFN3OSi |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-[[3-(2-bromo-5-fluoro-4-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cc(Br)ncc2F)c2ccccc21 |
| InChI | InChI=1S/C18H21BrFN3OSi/c1-25(2,3)9-8-24-12-23-16-7-5-4-6-13(16)18(22-23)14-10-17(19)21-11-15(14)20/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | WZWTULQNIQYCBM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|