C24H33BrFN3OSi — CID 166518877
2-[[3-(5-bromo-6-fluoro-2,5-dimethyl-1,3,4,4a-tetrahydroisoquinolin-1-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 166518877) has the molecular formula C24H33BrFN3OSi and a molecular weight of 506.54 g/mol. Its IUPAC name is 2-[[3-(5-bromo-6-fluoro-2,5-dimethyl-1,3,4,4a-tetrahydroisoquinolin-1-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(5-bromo-6-fluoro-2,5-dimethyl-1,3,4,4a-tetrahydroisoquinolin-1-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 166518877 |
| Molecular Formula | C24H33BrFN3OSi |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-[[3-(5-bromo-6-fluoro-2,5-dimethyl-1,3,4,4a-tetrahydroisoquinolin-1-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CN1CCC2C(=CC=C(F)C2(C)Br)C1c1nn(COCC[Si](C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C24H33BrFN3OSi/c1-24(25)19-12-13-28(2)23(17(19)10-11-21(24)26)22-18-8-6-7-9-20(18)29(27-22)16-30-14-15-31(3,4)5/h6-11,19,23H,12-16H2,1-5H3 |
| InChIKey | XMCBDLUDJMTDGA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|