C28H31BrFN3O3Si — CID 172516196
2-[(5-bromo-17-fluoro-7,11-dioxa-20,23,24-triazapentacyclo[17.5.2.12,6.013,18.022,25]heptacosa-1(24),2(27),3,5,13(18),14,16,19,21,25-decaen-23-yl)methoxy]ethyl-trimethylsilane (PubChem CID 172516196) has the molecular formula C28H31BrFN3O3Si and a molecular weight of 584.56 g/mol. Its IUPAC name is 2-[(5-bromo-17-fluoro-7,11-dioxa-20,23,24-triazapentacyclo[17.5.2.12,6.013,18.022,25]heptacosa-1(24),2(27),3,5,13(18),14,16,19,21,25-decaen-23-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-17-fluoro-7,11-dioxa-20,23,24-triazapentacyclo[17.5.2.12,6.013,18.022,25]heptacosa-1(24),2(27),3,5,13(18),14,16,19,21,25-decaen-23-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172516196 |
| Molecular Formula | C28H31BrFN3O3Si |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 2-[(5-bromo-17-fluoro-7,11-dioxa-20,23,24-triazapentacyclo[17.5.2.12,6.013,18.022,25]heptacosa-1(24),2(27),3,5,13(18),14,16,19,21,25-decaen-23-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc2c3cc(ncc31)-c1c(F)cccc1COCCCOc1cc-2ccc1Br |
| InChI | InChI=1S/C28H31BrFN3O3Si/c1-37(2,3)13-12-35-18-33-25-16-31-24-15-21(25)28(32-33)19-8-9-22(29)26(14-19)36-11-5-10-34-17-20-6-4-7-23(30)27(20)24/h4,6-9,14-16H,5,10-13,17-18H2,1-3H3 |
| InChIKey | NRZAKXZAMKBUGZ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|