C18H23ClN4OSi — CID 58540680
5-(3-chloro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine (PubChem CID 58540680) has the molecular formula C18H23ClN4OSi and a molecular weight of 374.95 g/mol. Its IUPAC name is 5-(3-chloro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine.
| Compound Name | 5-(3-chloro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
|---|---|
| PubChem CID | 58540680 |
| Molecular Formula | C18H23ClN4OSi |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-(3-chloro-2-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(N)c2cc(-c3ncccc3Cl)ccc21 |
| InChI | InChI=1S/C18H23ClN4OSi/c1-25(2,3)10-9-24-12-23-16-7-6-13(11-14(16)18(20)22-23)17-15(19)5-4-8-21-17/h4-8,11H,9-10,12H2,1-3H3,(H2,20,22) |
| InChIKey | JPGBXAPLJIRFOQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|