C17H22ClN5OSi — CID 90709871
3-(2-chloropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine (PubChem CID 90709871) has the molecular formula C17H22ClN5OSi and a molecular weight of 375.94 g/mol. Its IUPAC name is 3-(2-chloropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine.
| Compound Name | 3-(2-chloropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine |
|---|---|
| PubChem CID | 90709871 |
| Molecular Formula | C17H22ClN5OSi |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-(2-chloropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccnc(Cl)n2)c2c(N)cccc21 |
| InChI | InChI=1S/C17H22ClN5OSi/c1-25(2,3)10-9-24-11-23-14-6-4-5-12(19)15(14)16(22-23)13-7-8-20-17(18)21-13/h4-8H,9-11,19H2,1-3H3 |
| InChIKey | LAEKDLXLTGCBKJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|