C19H21ClF3N3OSi — CID 171933248
2-[[5-chloro-3-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171933248) has the molecular formula C19H21ClF3N3OSi and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-[[5-chloro-3-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-chloro-3-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171933248 |
| Molecular Formula | C19H21ClF3N3OSi |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[[5-chloro-3-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cccc(C(F)(F)F)c2)c2cc(Cl)ncc21 |
| InChI | InChI=1S/C19H21ClF3N3OSi/c1-28(2,3)8-7-27-12-26-16-11-24-17(20)10-15(16)18(25-26)13-5-4-6-14(9-13)19(21,22)23/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | PVNYKILKBYEZSS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|