C27H28F3N3OSi — CID 42612115
trimethyl-[2-[[4-phenyl-3-pyridin-3-yl-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 42612115) has the molecular formula C27H28F3N3OSi and a molecular weight of 495.62 g/mol. Its IUPAC name is trimethyl-[2-[[4-phenyl-3-pyridin-3-yl-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-phenyl-3-pyridin-3-yl-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 42612115 |
| Molecular Formula | C27H28F3N3OSi |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | trimethyl-[2-[[4-phenyl-3-pyridin-3-yl-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2cccnc2)c(-c2ccccc2)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H28F3N3OSi/c1-35(2,3)17-16-34-19-33-26(21-11-13-23(14-12-21)27(28,29)30)24(20-8-5-4-6-9-20)25(32-33)22-10-7-15-31-18-22/h4-15,18H,16-17,19H2,1-3H3 |
| InChIKey | GLTXUOACLLHXDF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|