C26H29N3O2SSi — CID 86699234
2-[[5-(4-methoxyphenyl)-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 86699234) has the molecular formula C26H29N3O2SSi and a molecular weight of 475.69 g/mol. Its IUPAC name is 2-[[5-(4-methoxyphenyl)-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(4-methoxyphenyl)-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 86699234 |
| Molecular Formula | C26H29N3O2SSi |
| Molecular Weight | 475.69 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[[5-(4-methoxyphenyl)-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ccc(-c2nn(COCC[Si](C)(C)C)c3c2Cc2sc(-c4cccnc4)cc2-3)cc1 |
| InChI | InChI=1S/C26H29N3O2SSi/c1-30-20-9-7-18(8-10-20)25-22-15-24-21(14-23(32-24)19-6-5-11-27-16-19)26(22)29(28-25)17-31-12-13-33(2,3)4/h5-11,14,16H,12-13,15,17H2,1-4H3 |
| InChIKey | BAKNHWRPHKEAET-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|