C24H24ClN5S — CID 71815380
5-[4-(4-methylpiperazin-1-yl)phenyl]-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene;hydrochloride (PubChem CID 71815380) has the molecular formula C24H24ClN5S and a molecular weight of 450.01 g/mol. Its IUPAC name is 5-[4-(4-methylpiperazin-1-yl)phenyl]-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene;hydrochloride.
| Compound Name | 5-[4-(4-methylpiperazin-1-yl)phenyl]-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene;hydrochloride |
|---|---|
| PubChem CID | 71815380 |
| Molecular Formula | C24H24ClN5S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 5-[4-(4-methylpiperazin-1-yl)phenyl]-10-pyridin-3-yl-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene;hydrochloride |
| SMILES | CN1CCN(c2ccc(-c3n[nH]c4c3Cc3sc(-c5cccnc5)cc3-4)cc2)CC1.Cl |
| InChI | InChI=1S/C24H23N5S.ClH/c1-28-9-11-29(12-10-28)18-6-4-16(5-7-18)23-20-14-22-19(24(20)27-26-23)13-21(30-22)17-3-2-8-25-15-17;/h2-8,13,15H,9-12,14H2,1H3,(H,26,27);1H |
| InChIKey | LWJRVEBAZFTEGR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |