C23H21N3S — CID 166882834
6-(4-piperidin-1-ylphenyl)-2-pyridin-3-ylthieno[2,3-b]pyridine (PubChem CID 166882834) has the molecular formula C23H21N3S and a molecular weight of 371.51 g/mol. Its IUPAC name is 6-(4-piperidin-1-ylphenyl)-2-pyridin-3-ylthieno[2,3-b]pyridine.
| Compound Name | 6-(4-piperidin-1-ylphenyl)-2-pyridin-3-ylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 166882834 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 6-(4-piperidin-1-ylphenyl)-2-pyridin-3-ylthieno[2,3-b]pyridine |
| SMILES | c1cncc(-c2cc3ccc(-c4ccc(N5CCCCC5)cc4)nc3s2)c1 |
| InChI | InChI=1S/C23H21N3S/c1-2-13-26(14-3-1)20-9-6-17(7-10-20)21-11-8-18-15-22(27-23(18)25-21)19-5-4-12-24-16-19/h4-12,15-16H,1-3,13-14H2 |
| InChIKey | PHIVQKBGDHDILB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |