C19H22N3OPS — CID 167073464
2-[1-(2-pyridin-3-ylthieno[2,3-b]pyridin-6-yl)piperidin-4-yl]oxyethylphosphane (PubChem CID 167073464) has the molecular formula C19H22N3OPS and a molecular weight of 371.45 g/mol. Its IUPAC name is 2-[1-(2-pyridin-3-ylthieno[2,3-b]pyridin-6-yl)piperidin-4-yl]oxyethylphosphane.
| Compound Name | 2-[1-(2-pyridin-3-ylthieno[2,3-b]pyridin-6-yl)piperidin-4-yl]oxyethylphosphane |
|---|---|
| PubChem CID | 167073464 |
| Molecular Formula | C19H22N3OPS |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[1-(2-pyridin-3-ylthieno[2,3-b]pyridin-6-yl)piperidin-4-yl]oxyethylphosphane |
| SMILES | PCCOC1CCN(c2ccc3cc(-c4cccnc4)sc3n2)CC1 |
| InChI | InChI=1S/C19H22N3OPS/c24-11-10-23-16-5-8-22(9-6-16)18-4-3-14-12-17(25-19(14)21-18)15-2-1-7-20-13-15/h1-4,7,12-13,16H,5-6,8-11,24H2 |
| InChIKey | UQGPMPYZHGRKCE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|