C21H24FN3OS — CID 146171943
2-[6-[4-(4-fluorobutoxy)piperidin-1-yl]-3-pyridinyl]-1,3-benzothiazole (PubChem CID 146171943) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[6-[4-(4-fluorobutoxy)piperidin-1-yl]-3-pyridinyl]-1,3-benzothiazole.
| Compound Name | 2-[6-[4-(4-fluorobutoxy)piperidin-1-yl]-3-pyridinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146171943 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[6-[4-(4-fluorobutoxy)piperidin-1-yl]-3-pyridinyl]-1,3-benzothiazole |
| SMILES | FCCCCOC1CCN(c2ccc(-c3nc4ccccc4s3)cn2)CC1 |
| InChI | InChI=1S/C21H24FN3OS/c22-11-3-4-14-26-17-9-12-25(13-10-17)20-8-7-16(15-23-20)21-24-18-5-1-2-6-19(18)27-21/h1-2,5-8,15,17H,3-4,9-14H2 |
| InChIKey | VSVUPFUMDKADRG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|