C16H16N4OS — CID 167985106
1-[5-(1,3-benzothiazol-2-yl)pyrimidin-2-yl]piperidin-4-ol (PubChem CID 167985106) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-yl)pyrimidin-2-yl]piperidin-4-ol.
| Compound Name | 1-[5-(1,3-benzothiazol-2-yl)pyrimidin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 167985106 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-yl)pyrimidin-2-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2ncc(-c3nc4ccccc4s3)cn2)CC1 |
| InChI | InChI=1S/C16H16N4OS/c21-12-5-7-20(8-6-12)16-17-9-11(10-18-16)15-19-13-3-1-2-4-14(13)22-15/h1-4,9-10,12,21H,5-8H2 |
| InChIKey | YIRBRXVCEQXZMF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |