C16H17N5O — CID 167978285
1-[5-(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrimidin-2-yl]piperidin-4-ol (PubChem CID 167978285) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[5-(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrimidin-2-yl]piperidin-4-ol.
| Compound Name | 1-[5-(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrimidin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 167978285 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[5-(1H-pyrrolo[2,3-b]pyridin-2-yl)pyrimidin-2-yl]piperidin-4-ol |
| SMILES | OC1CCN(c2ncc(-c3cc4cccnc4[nH]3)cn2)CC1 |
| InChI | InChI=1S/C16H17N5O/c22-13-3-6-21(7-4-13)16-18-9-12(10-19-16)14-8-11-2-1-5-17-15(11)20-14/h1-2,5,8-10,13,22H,3-4,6-7H2,(H,17,20) |
| InChIKey | AMKMCYJKEKXFFK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |