C10H14FN3O — CID 89185599
1-[3-(fluoroamino)-2-pyridinyl]piperidin-4-ol (PubChem CID 89185599) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 1-[3-(fluoroamino)-2-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[3-(fluoroamino)-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 89185599 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-[3-(fluoroamino)-2-pyridinyl]piperidin-4-ol |
| SMILES | OC1CCN(c2ncccc2NF)CC1 |
| InChI | InChI=1S/C10H14FN3O/c11-13-9-2-1-5-12-10(9)14-6-3-8(15)4-7-14/h1-2,5,8,13,15H,3-4,6-7H2 |
| InChIKey | RPCUWQNPEGWLGQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|