C15H18N4O — CID 123614324
1-[4-(pyrimidin-2-ylamino)phenyl]piperidin-4-ol (PubChem CID 123614324) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[4-(pyrimidin-2-ylamino)phenyl]piperidin-4-ol.
| Compound Name | 1-[4-(pyrimidin-2-ylamino)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 123614324 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[4-(pyrimidin-2-ylamino)phenyl]piperidin-4-ol |
| SMILES | OC1CCN(c2ccc(Nc3ncccn3)cc2)CC1 |
| InChI | InChI=1S/C15H18N4O/c20-14-6-10-19(11-7-14)13-4-2-12(3-5-13)18-15-16-8-1-9-17-15/h1-5,8-9,14,20H,6-7,10-11H2,(H,16,17,18) |
| InChIKey | PCPVUMSABIVNPO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|