C16H18N4O — CID 141392333
N-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]pyrimidin-2-amine (PubChem CID 141392333) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]pyrimidin-2-amine.
| Compound Name | N-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141392333 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[4-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]pyrimidin-2-amine |
| SMILES | c1cnc(Nc2ccc(N3CC4CCC(C3)O4)cc2)nc1 |
| InChI | InChI=1S/C16H18N4O/c1-8-17-16(18-9-1)19-12-2-4-13(5-3-12)20-10-14-6-7-15(11-20)21-14/h1-5,8-9,14-15H,6-7,10-11H2,(H,17,18,19) |
| InChIKey | MUKSQCCAUBCDJW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|