C16H17N5O — CID 141271458
(3S)-1-[4-(imidazo[1,2-a]pyrazin-8-ylamino)phenyl]pyrrolidin-3-ol (PubChem CID 141271458) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is (3S)-1-[4-(imidazo[1,2-a]pyrazin-8-ylamino)phenyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[4-(imidazo[1,2-a]pyrazin-8-ylamino)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 141271458 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3S)-1-[4-(imidazo[1,2-a]pyrazin-8-ylamino)phenyl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(c2ccc(Nc3nccn4ccnc34)cc2)C1 |
| InChI | InChI=1S/C16H17N5O/c22-14-5-8-21(11-14)13-3-1-12(2-4-13)19-15-16-18-7-10-20(16)9-6-17-15/h1-4,6-7,9-10,14,22H,5,8,11H2,(H,17,19)/t14-/m0/s1 |
| InChIKey | QLGVTYIEENFCPK-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|