C21H29N7 — CID 143460673
2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143460673) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143460673 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC(C)=CNN.c1cn2ccnc2c(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C17H19N5.C4H10N2/c1-2-10-21(11-3-1)15-6-4-14(5-7-15)20-16-17-19-9-13-22(17)12-8-18-16;1-4(2)3-6-5/h4-9,12-13H,1-3,10-11H2,(H,18,20);3,6H,5H2,1-2H3 |
| InChIKey | WTYUSNCXGCDQRQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|