About 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine
2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143460673) has the molecular formula C21H29N7
and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 143460673 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC(C)=CNN.c1cn2ccnc2c(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C17H19N5.C4H10N2/c1-2-10-21(11-3-1)15-6-4-14(5-7-15)20-16-17-19-9-13-22(17)12-8-18-16;1-4(2)3-6-5/h4-9,12-13H,1-3,10-11H2,(H,18,20);3,6H,5H2,1-2H3 |
| InChIKey | WTYUSNCXGCDQRQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (CID 143460673) is 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine is CC(C)=CNN.c1cn2ccnc2c(Nc2ccc(N3CCCCC3)cc2)n1.
What is the InChIKey of 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine?
The InChIKey is WTYUSNCXGCDQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5.C4H10N2/c1-2-10-21(11-3-1)15-6-4-14(5-7-15)20-16-17-19-9-13-22(17)12-8-18-16;1-4(2)3-6-5/h4-9,12-13H,1-3,10-11H2,(H,18,20);3,6H,5H2,1-2H3.
What are the key properties of 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine?
2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine has a molecular weight of 379.51 g/mol, XLogP of 3.84, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-enylhydrazine;N-(4-piperidin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 143460673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).