C18H23N5 — CID 97185147
N-[(E)-1-[4-(azepan-1-yl)phenyl]ethylideneamino]pyrimidin-2-amine (PubChem CID 97185147) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[(E)-1-[4-(azepan-1-yl)phenyl]ethylideneamino]pyrimidin-2-amine.
| Compound Name | N-[(E)-1-[4-(azepan-1-yl)phenyl]ethylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 97185147 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[(E)-1-[4-(azepan-1-yl)phenyl]ethylideneamino]pyrimidin-2-amine |
| SMILES | C/C(=N\Nc1ncccn1)c1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H23N5/c1-15(21-22-18-19-11-6-12-20-18)16-7-9-17(10-8-16)23-13-4-2-3-5-14-23/h6-12H,2-5,13-14H2,1H3,(H,19,20,22)/b21-15+ |
| InChIKey | IGQIPKLBNKKVHH-RCCKNPSSSA-N |
| XLogP | 3.69 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|