C18H22N4 — CID 9121631
N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]pyridin-2-amine (PubChem CID 9121631) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 9121631 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]pyridin-2-amine |
| SMILES | C/C(=N/Nc1ccccn1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H22N4/c1-15(20-21-18-7-3-4-12-19-18)16-8-10-17(11-9-16)22-13-5-2-6-14-22/h3-4,7-12H,2,5-6,13-14H2,1H3,(H,19,21)/b20-15- |
| InChIKey | OGDYALFPFMLWPP-HKWRFOASSA-N |
| XLogP | 3.91 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|