C20H27N4O+ — CID 9121744
N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]pyridin-2-amine (PubChem CID 9121744) has the molecular formula C20H27N4O+ and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]pyridin-2-amine.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 9121744 |
| Molecular Formula | C20H27N4O+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]pyridin-2-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2ccccn2)cc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C20H26N4O/c1-16(22-23-20-8-4-5-11-21-20)17-9-10-19(25-2)18(14-17)15-24-12-6-3-7-13-24/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3,(H,21,23)/p+1/b22-16- |
| InChIKey | CQNAHKGVFJVWLX-JWGURIENSA-O |
| XLogP | 2.50 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|