C20H26N3O3+ — CID 9359533
N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-2-methylfuran-3-carboxamide (PubChem CID 9359533) has the molecular formula C20H26N3O3+ and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 9359533 |
| Molecular Formula | C20H26N3O3+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]-2-methylfuran-3-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccoc2C)cc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C20H25N3O3/c1-14(21-22-20(24)18-8-11-26-15(18)2)16-6-7-19(25-3)17(12-16)13-23-9-4-5-10-23/h6-8,11-12H,4-5,9-10,13H2,1-3H3,(H,22,24)/p+1/b21-14- |
| InChIKey | QDFYFLMDHBPPET-STZFKDTASA-O |
| XLogP | 1.93 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|