C21H27N4O5+ — CID 9352942
N-(furan-2-ylmethyl)-N'-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]oxamide (PubChem CID 9352942) has the molecular formula C21H27N4O5+ and a molecular weight of 415.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 9352942 |
| Molecular Formula | C21H27N4O5+ |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]oxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)C(=O)NCc2ccco2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C21H26N4O5/c1-15(23-24-21(27)20(26)22-13-18-4-3-9-30-18)16-5-6-19(28-2)17(12-16)14-25-7-10-29-11-8-25/h3-6,9,12H,7-8,10-11,13-14H2,1-2H3,(H,22,26)(H,24,27)/p+1/b23-15- |
| InChIKey | SRYZIKIYZSFCBG-HAHDFKILSA-O |
| XLogP | -0.14 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|