C19H24N3O3S+ — CID 9176517
N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]thiophene-2-carboxamide (PubChem CID 9176517) has the molecular formula C19H24N3O3S+ and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9176517 |
| Molecular Formula | C19H24N3O3S+ |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ium-4-ylmethyl)phenyl]ethylideneamino]thiophene-2-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2cccs2)cc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H23N3O3S/c1-14(20-21-19(23)18-4-3-11-26-18)15-5-6-17(24-2)16(12-15)13-22-7-9-25-10-8-22/h3-6,11-12H,7-10,13H2,1-2H3,(H,21,23)/p+1/b20-14- |
| InChIKey | DYRJAWLQFJTAIV-ZHZULCJRSA-O |
| XLogP | 1.33 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|