C23H30N3O4+ — CID 9232532
3,4-dimethoxy-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]benzamide (PubChem CID 9232532) has the molecular formula C23H30N3O4+ and a molecular weight of 412.51 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 9232532 |
| Molecular Formula | C23H30N3O4+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3,4-dimethoxy-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ium-1-ylmethyl)phenyl]ethylideneamino]benzamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccc(OC)c(OC)c2)cc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C23H29N3O4/c1-16(24-25-23(27)18-8-10-21(29-3)22(14-18)30-4)17-7-9-20(28-2)19(13-17)15-26-11-5-6-12-26/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H,25,27)/p+1/b24-16- |
| InChIKey | SJFFFELMGKLAJC-JLPGSUDCSA-O |
| XLogP | 2.05 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|