C15H24N3O+ — CID 7250182
(Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylidenehydrazine (PubChem CID 7250182) has the molecular formula C15H24N3O+ and a molecular weight of 262.38 g/mol. Its IUPAC name is (Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylidenehydrazine.
| Compound Name | (Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylidenehydrazine |
|---|---|
| PubChem CID | 7250182 |
| Molecular Formula | C15H24N3O+ |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (Z)-1-[4-methoxy-3-(piperidin-1-ium-1-ylmethyl)phenyl]ethylidenehydrazine |
| SMILES | COc1ccc(/C(C)=N\N)cc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C15H23N3O/c1-12(17-16)13-6-7-15(19-2)14(10-13)11-18-8-4-3-5-9-18/h6-7,10H,3-5,8-9,11,16H2,1-2H3/p+1/b17-12- |
| InChIKey | SBCJTKMWCXWAQL-ATVHPVEESA-O |
| XLogP | 0.95 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|