C23H23N3O5 — CID 6005646
N-[(Z)-1-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]ethylideneamino]-2-methylfuran-3-carboxamide (PubChem CID 6005646) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[(Z)-1-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]ethylideneamino]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(Z)-1-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]ethylideneamino]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 6005646 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[(Z)-1-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]ethylideneamino]-2-methylfuran-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(/C(C)=N\NC(=O)c3ccoc3C)c2)cc1OC |
| InChI | InChI=1S/C23H23N3O5/c1-14(25-26-23(28)19-10-11-31-15(19)2)16-6-5-7-18(12-16)24-22(27)17-8-9-20(29-3)21(13-17)30-4/h5-13H,1-4H3,(H,24,27)(H,26,28)/b25-14- |
| InChIKey | FQYCUQSDNFVSKL-QFEZKATASA-N |
| XLogP | 4.01 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|