C23H23N3O5S — CID 1009138
N-[3-[N-(benzenesulfonamido)-C-methylcarbonimidoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 1009138) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[3-[N-(benzenesulfonamido)-C-methylcarbonimidoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-[N-(benzenesulfonamido)-C-methylcarbonimidoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1009138 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[3-[N-(benzenesulfonamido)-C-methylcarbonimidoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(C(C)=NNS(=O)(=O)c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C23H23N3O5S/c1-16(25-26-32(28,29)20-10-5-4-6-11-20)17-8-7-9-19(14-17)24-23(27)18-12-13-21(30-2)22(15-18)31-3/h4-15,26H,1-3H3,(H,24,27) |
| InChIKey | FHYMEEZLYCREKR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|