C20H19N3O5S — CID 20910382
5-(benzenesulfonamido)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 20910382) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(benzenesulfonamido)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 20910382 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 5-(benzenesulfonamido)-N-(3,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cncc(NS(=O)(=O)c3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C20H19N3O5S/c1-27-18-9-8-15(11-19(18)28-2)22-20(24)14-10-16(13-21-12-14)23-29(25,26)17-6-4-3-5-7-17/h3-13,23H,1-2H3,(H,22,24) |
| InChIKey | DQOURMWZSLLPGD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |