C24H25N3O5S — CID 6016904
3,4-dimethoxy-N-[3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]phenyl]benzamide (PubChem CID 6016904) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6016904 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[(Z)-C-methyl-N-[(4-methylphenyl)sulfonylamino]carbonimidoyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(/C(C)=N\NS(=O)(=O)c3ccc(C)cc3)c2)cc1OC |
| InChI | InChI=1S/C24H25N3O5S/c1-16-8-11-21(12-9-16)33(29,30)27-26-17(2)18-6-5-7-20(14-18)25-24(28)19-10-13-22(31-3)23(15-19)32-4/h5-15,27H,1-4H3,(H,25,28)/b26-17- |
| InChIKey | GAPGDTHLKYVWOE-ONUIUJJFSA-N |
| XLogP | 3.97 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|