C20H26N6O4S — CID 172753640
methanesulfonic acid;N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 172753640) has the molecular formula C20H26N6O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is methanesulfonic acid;N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | methanesulfonic acid;N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 172753640 |
| Molecular Formula | C20H26N6O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | methanesulfonic acid;N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CS(=O)(=O)O.c1cn2ccnc2c(Nc2ccc(N3CCN(C4COC4)CC3)cc2)n1 |
| InChI | InChI=1S/C19H22N6O.CH4O3S/c1-3-16(23-9-11-24(12-10-23)17-13-26-14-17)4-2-15(1)22-18-19-21-6-8-25(19)7-5-20-18;1-5(2,3)4/h1-8,17H,9-14H2,(H,20,22);1H3,(H,2,3,4) |
| InChIKey | KSJJHQZEQLXJTG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|