C20H23BrN6O2 — CID 86705413
6-bromo-N-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 86705413) has the molecular formula C20H23BrN6O2 and a molecular weight of 459.35 g/mol. Its IUPAC name is 6-bromo-N-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-bromo-N-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 86705413 |
| Molecular Formula | C20H23BrN6O2 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 6-bromo-N-[3-methoxy-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1cc(Nc2nc(Br)cn3ccnc23)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C20H23BrN6O2/c1-28-17-10-14(23-19-20-22-4-5-27(20)11-18(21)24-19)2-3-16(17)26-8-6-25(7-9-26)15-12-29-13-15/h2-5,10-11,15H,6-9,12-13H2,1H3,(H,23,24) |
| InChIKey | UGVUBHDTUSNXOU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|