C23H25N9O — CID 155635343
5-(6-aminopyrazin-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 155635343) has the molecular formula C23H25N9O and a molecular weight of 443.52 g/mol. Its IUPAC name is 5-(6-aminopyrazin-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 5-(6-aminopyrazin-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 155635343 |
| Molecular Formula | C23H25N9O |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 5-(6-aminopyrazin-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Nc1cncc(-c2cnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)c3nccn23)n1 |
| InChI | InChI=1S/C23H25N9O/c24-21-13-25-11-19(29-21)20-12-27-22(23-26-5-6-32(20)23)28-16-1-3-17(4-2-16)30-7-9-31(10-8-30)18-14-33-15-18/h1-6,11-13,18H,7-10,14-15H2,(H2,24,29)(H,27,28) |
| InChIKey | HZEOWKXBNMPHSN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|