C16H26N4O — CID 145054361
acetylene;ethane;5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-amine (PubChem CID 145054361) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is acetylene;ethane;5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-amine.
| Compound Name | acetylene;ethane;5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 145054361 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | acetylene;ethane;5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-amine |
| SMILES | C#C.CC.Nc1ccc(N2CCN(C3COC3)CC2)cn1 |
| InChI | InChI=1S/C12H18N4O.C2H6.C2H2/c13-12-2-1-10(7-14-12)15-3-5-16(6-4-15)11-8-17-9-11;2*1-2/h1-2,7,11H,3-6,8-9H2,(H2,13,14);1-2H3;1-2H |
| InChIKey | YGROTDRKWUQTBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|