C22H23N7OS — CID 59023121
4-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-2-carboxamide (PubChem CID 59023121) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-2-carboxamide.
| Compound Name | 4-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59023121 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-2-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4csc(C(N)=O)c4)n4ccnc34)cc2)CC1 |
| InChI | InChI=1S/C22H23N7OS/c1-27-8-10-28(11-9-27)17-4-2-16(3-5-17)26-21-22-24-6-7-29(22)18(13-25-21)15-12-19(20(23)30)31-14-15/h2-7,12-14H,8-11H2,1H3,(H2,23,30)(H,25,26) |
| InChIKey | FTRKWYPZQHTBDU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|