C21H22N8O2S — CID 68792133
[5-[8-[4-(4-methylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl] carbamate (PubChem CID 68792133) has the molecular formula C21H22N8O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is [5-[8-[4-(4-methylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl] carbamate.
| Compound Name | [5-[8-[4-(4-methylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl] carbamate |
|---|---|
| PubChem CID | 68792133 |
| Molecular Formula | C21H22N8O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [5-[8-[4-(4-methylpiperazin-1-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]thiophen-2-yl] carbamate |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4ccc(OC(N)=O)s4)n4ncnc34)cc2)CC1 |
| InChI | InChI=1S/C21H22N8O2S/c1-27-8-10-28(11-9-27)15-4-2-14(3-5-15)26-19-20-24-13-25-29(20)16(12-23-19)17-6-7-18(32-17)31-21(22)30/h2-7,12-13H,8-11H2,1H3,(H2,22,30)(H,23,26) |
| InChIKey | CATQNOMHERUMQE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|