C23H22N8O — CID 143585612
5-[8-(4-piperazin-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one (PubChem CID 143585612) has the molecular formula C23H22N8O and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-[8-(4-piperazin-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[8-(4-piperazin-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 143585612 |
| Molecular Formula | C23H22N8O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5-[8-(4-piperazin-1-ylanilino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(-c3cnc(Nc4ccc(N5CCNCC5)cc4)c4ncnn34)ccc21 |
| InChI | InChI=1S/C23H22N8O/c32-23-19-6-1-15(11-16(19)12-26-23)20-13-25-21(22-27-14-28-31(20)22)29-17-2-4-18(5-3-17)30-9-7-24-8-10-30/h1-6,11,13-14,24H,7-10,12H2,(H,25,29)(H,26,32) |
| InChIKey | JQVMPPRJXWASDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|